BDBM159545 US10093663, Example 17-30::US9682968, Example-17-15::US9682968, Example-17-30
SMILES CCC1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)C(C1)c1ccc(cc1)C(O)=O
InChI Key
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 159545
Affinity DataIC50: 0.0200nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 13nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 23nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 0.0100nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair